C17H18N2O4 — CID 163646977
N-(4-hydroxyphenyl)-N'-(2-propoxyphenyl)oxamide (PubChem CID 163646977) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-N'-(2-propoxyphenyl)oxamide.
| Compound Name | N-(4-hydroxyphenyl)-N'-(2-propoxyphenyl)oxamide |
|---|---|
| PubChem CID | 163646977 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(4-hydroxyphenyl)-N'-(2-propoxyphenyl)oxamide |
| SMILES | CCCOc1ccccc1NC(=O)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-2-11-23-15-6-4-3-5-14(15)19-17(22)16(21)18-12-7-9-13(20)10-8-12/h3-10,20H,2,11H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | IJBIBVXENLAWBK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|