C12H13N5O3 — CID 108529879
N-(2-ethoxyphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide (PubChem CID 108529879) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide.
| Compound Name | N-(2-ethoxyphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide |
|---|---|
| PubChem CID | 108529879 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N-(2-ethoxyphenyl)-N'-(1H-1,2,4-triazol-5-yl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C12H13N5O3/c1-2-20-9-6-4-3-5-8(9)15-10(18)11(19)16-12-13-7-14-17-12/h3-7H,2H2,1H3,(H,15,18)(H2,13,14,16,17,19) |
| InChIKey | QCZGPQSLENLRGA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|