C16H22N2O3 — CID 7585382
N-cyclohexyl-N'-(2-ethoxyphenyl)oxamide (PubChem CID 7585382) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-cyclohexyl-N'-(2-ethoxyphenyl)oxamide.
| Compound Name | N-cyclohexyl-N'-(2-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 7585382 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-cyclohexyl-N'-(2-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H22N2O3/c1-2-21-14-11-7-6-10-13(14)18-16(20)15(19)17-12-8-4-3-5-9-12/h6-7,10-12H,2-5,8-9H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | CJODHTGNOBRGJJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|