C14H18N2O2 — CID 2290931
N-cyclopentyl-N'-(2-methylphenyl)oxamide (PubChem CID 2290931) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-cyclopentyl-N'-(2-methylphenyl)oxamide.
| Compound Name | N-cyclopentyl-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 2290931 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-cyclopentyl-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H18N2O2/c1-10-6-2-5-9-12(10)16-14(18)13(17)15-11-7-3-4-8-11/h2,5-6,9,11H,3-4,7-8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | IQNXPAIWNVNHBV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|