About N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide
N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide (PubChem CID 108514360) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide |
| PubChem CID | 108514360 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide |
| SMILES | O=C(Nc1ccccc1O)C(=O)NC1CC1 |
| InChI | InChI=1S/C11H12N2O3/c14-9-4-2-1-3-8(9)13-11(16)10(15)12-7-5-6-7/h1-4,7,14H,5-6H2,(H,12,15)(H,13,16) |
| InChIKey | KEVIZAAMEFAIMX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide?
The IUPAC name of N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide (CID 108514360) is N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide.
What is the SMILES notation for N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide?
The canonical SMILES for N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide is O=C(Nc1ccccc1O)C(=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide?
The InChIKey is KEVIZAAMEFAIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c14-9-4-2-1-3-8(9)13-11(16)10(15)12-7-5-6-7/h1-4,7,14H,5-6H2,(H,12,15)(H,13,16).
What are the key properties of N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide?
N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide has a molecular weight of 220.23 g/mol, XLogP of 0.61, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-(2-hydroxyphenyl)oxamide is sourced from PubChem (CID 108514360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).