C14H15F3N2O2 — CID 45000423
N-cyclopentyl-N'-[2-(trifluoromethyl)phenyl]oxamide (PubChem CID 45000423) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is N-cyclopentyl-N'-[2-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-cyclopentyl-N'-[2-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 45000423 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-cyclopentyl-N'-[2-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H15F3N2O2/c15-14(16,17)10-7-3-4-8-11(10)19-13(21)12(20)18-9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2,(H,18,20)(H,19,21) |
| InChIKey | RWTQTSIKGDQJRB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|