C17H18F3N3O — CID 108831343
(Z)-2-cyano-N-cyclohexyl-3-[2-(trifluoromethyl)anilino]prop-2-enamide (PubChem CID 108831343) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-[2-(trifluoromethyl)anilino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-[2-(trifluoromethyl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108831343 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-[2-(trifluoromethyl)anilino]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1C(F)(F)F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H18F3N3O/c18-17(19,20)14-8-4-5-9-15(14)22-11-12(10-21)16(24)23-13-6-2-1-3-7-13/h4-5,8-9,11,13,22H,1-3,6-7H2,(H,23,24)/b12-11- |
| InChIKey | DQMMXYOPQGPDEU-QXMHVHEDSA-N |
| XLogP | 3.97 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|