C16H10F6N2O2 — CID 3696493
N,N'-bis[2-(trifluoromethyl)phenyl]oxamide (PubChem CID 3696493) has the molecular formula C16H10F6N2O2 and a molecular weight of 376.26 g/mol. Its IUPAC name is N,N'-bis[2-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N,N'-bis[2-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 3696493 |
| Molecular Formula | C16H10F6N2O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N,N'-bis[2-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H10F6N2O2/c17-15(18,19)9-5-1-3-7-11(9)23-13(25)14(26)24-12-8-4-2-6-10(12)16(20,21)22/h1-8H,(H,23,25)(H,24,26) |
| InChIKey | KYWNEGLHPCMJES-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|