C16H13F3N2O3 — CID 45000476
N-(3-methoxyphenyl)-N'-[2-(trifluoromethyl)phenyl]oxamide (PubChem CID 45000476) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N'-[2-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(3-methoxyphenyl)-N'-[2-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 45000476 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-(3-methoxyphenyl)-N'-[2-(trifluoromethyl)phenyl]oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N2O3/c1-24-11-6-4-5-10(9-11)20-14(22)15(23)21-13-8-3-2-7-12(13)16(17,18)19/h2-9H,1H3,(H,20,22)(H,21,23) |
| InChIKey | FSDPSVBVOFOLMA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|