About N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide
N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide (PubChem CID 108987248) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide |
| PubChem CID | 108987248 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)Nc2ccccc2Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H18N2O4/c1-26-17-11-7-8-15(14-17)22-20(24)21(25)23-18-12-5-6-13-19(18)27-16-9-3-2-4-10-16/h2-14H,1H3,(H,22,24)(H,23,25) |
| InChIKey | ONRVHSKQBPSWAZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide?
The IUPAC name of N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide (CID 108987248) is N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide.
What is the SMILES notation for N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide?
The canonical SMILES for N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide is COc1cccc(NC(=O)C(=O)Nc2ccccc2Oc2ccccc2)c1.
What is the InChIKey of N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide?
The InChIKey is ONRVHSKQBPSWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4/c1-26-17-11-7-8-15(14-17)22-20(24)21(25)23-18-12-5-6-13-19(18)27-16-9-3-2-4-10-16/h2-14H,1H3,(H,22,24)(H,23,25).
What are the key properties of N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide?
N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide has a molecular weight of 362.39 g/mol, XLogP of 4.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-N'-(2-phenoxyphenyl)oxamide is sourced from PubChem (CID 108987248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).