C11H5Cl2F3NO3- — CID 7315411
(Z)-2,3-dichloro-4-oxo-4-[2-(trifluoromethyl)anilino]but-2-enoate (PubChem CID 7315411) has the molecular formula C11H5Cl2F3NO3- and a molecular weight of 327.07 g/mol. Its IUPAC name is (Z)-2,3-dichloro-4-oxo-4-[2-(trifluoromethyl)anilino]but-2-enoate.
| Compound Name | (Z)-2,3-dichloro-4-oxo-4-[2-(trifluoromethyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 7315411 |
| Molecular Formula | C11H5Cl2F3NO3- |
| Molecular Weight | 327.07 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | (Z)-2,3-dichloro-4-oxo-4-[2-(trifluoromethyl)anilino]but-2-enoate |
| SMILES | O=C([O-])/C(Cl)=C(/Cl)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H6Cl2F3NO3/c12-7(8(13)10(19)20)9(18)17-6-4-2-1-3-5(6)11(14,15)16/h1-4H,(H,17,18)(H,19,20)/p-1/b8-7- |
| InChIKey | FVKVSAGSMXZGHE-FPLPWBNLSA-M |
| XLogP | 2.08 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.07 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|