C24H21NO3 — CID 19165915
ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate (PubChem CID 19165915) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 19165915 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl 2-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21NO3/c1-2-28-24(27)20-15-9-10-16-22(20)25-23(26)21(19-13-7-4-8-14-19)17-18-11-5-3-6-12-18/h3-17H,2H2,1H3,(H,25,26)/b21-17+ |
| InChIKey | UIPLQKGTRBQAPO-HEHNFIMWSA-N |
| XLogP | 5.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|