C24H22N2O5 — CID 108757090
ethyl 4-carbamoyl-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate (PubChem CID 108757090) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl 4-carbamoyl-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 108757090 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl 4-carbamoyl-5-[[(Z)-2,3-diphenylprop-2-enoyl]amino]-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)/C(=C\c2ccccc2)c2ccccc2)c1C(N)=O |
| InChI | InChI=1S/C24H22N2O5/c1-3-30-24(29)19-15(2)31-23(20(19)21(25)27)26-22(28)18(17-12-8-5-9-13-17)14-16-10-6-4-7-11-16/h4-14H,3H2,1-2H3,(H2,25,27)(H,26,28)/b18-14- |
| InChIKey | OQJYCZDCDAPSGX-JXAWBTAJSA-N |
| XLogP | 4.04 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|