C19H20N2O7 — CID 9202543
ethyl 4-carbamoyl-2-methyl-5-[[2-(2-methylbenzoyl)oxyacetyl]amino]furan-3-carboxylate (PubChem CID 9202543) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is ethyl 4-carbamoyl-2-methyl-5-[[2-(2-methylbenzoyl)oxyacetyl]amino]furan-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-2-methyl-5-[[2-(2-methylbenzoyl)oxyacetyl]amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 9202543 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | ethyl 4-carbamoyl-2-methyl-5-[[2-(2-methylbenzoyl)oxyacetyl]amino]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)COC(=O)c2ccccc2C)c1C(N)=O |
| InChI | InChI=1S/C19H20N2O7/c1-4-26-19(25)14-11(3)28-17(15(14)16(20)23)21-13(22)9-27-18(24)12-8-6-5-7-10(12)2/h5-8H,4,9H2,1-3H3,(H2,20,23)(H,21,22) |
| InChIKey | KRONALXJMCLNQY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |