C18H22N2O7 — CID 8566868
ethyl 4-carbamoyl-5-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-2-methylfuran-3-carboxylate (PubChem CID 8566868) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is ethyl 4-carbamoyl-5-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-5-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8566868 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | ethyl 4-carbamoyl-5-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)COC(=O)[C@@H]2CC=CCC2)c1C(N)=O |
| InChI | InChI=1S/C18H22N2O7/c1-3-25-18(24)13-10(2)27-16(14(13)15(19)22)20-12(21)9-26-17(23)11-7-5-4-6-8-11/h4-5,11H,3,6-9H2,1-2H3,(H2,19,22)(H,20,21)/t11-/m1/s1 |
| InChIKey | GIDWDNOGBASKCK-LLVKDONJSA-N |
| XLogP | 1.70 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|