C17H21NO5S — CID 7932256
methyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 7932256) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is methyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7932256 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COC(=O)[C@@H]2CC=CCC2)sc(C)c1C |
| InChI | InChI=1S/C17H21NO5S/c1-10-11(2)24-15(14(10)17(21)22-3)18-13(19)9-23-16(20)12-7-5-4-6-8-12/h4-5,12H,6-9H2,1-3H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | PDWXEUSKHZGQLZ-GFCCVEGCSA-N |
| XLogP | 2.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|