C19H25NO5S — CID 7932221
ethyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate (PubChem CID 7932221) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is ethyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7932221 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | ethyl 2-[[2-[(1S)-cyclohex-3-ene-1-carbonyl]oxyacetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)C)sc1NC(=O)COC(=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C19H25NO5S/c1-4-24-19(23)14-10-15(12(2)3)26-17(14)20-16(21)11-25-18(22)13-8-6-5-7-9-13/h5-6,10,12-13H,4,7-9,11H2,1-3H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | ODIJUSPFJQNHHQ-CYBMUJFWSA-N |
| XLogP | 3.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|