C23H31NO5S — CID 3642795
ethyl 2-[[2-(adamantane-1-carbonyloxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate (PubChem CID 3642795) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is ethyl 2-[[2-(adamantane-1-carbonyloxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(adamantane-1-carbonyloxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3642795 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | ethyl 2-[[2-(adamantane-1-carbonyloxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)C)sc1NC(=O)COC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO5S/c1-4-28-21(26)17-8-18(13(2)3)30-20(17)24-19(25)12-29-22(27)23-9-14-5-15(10-23)7-16(6-14)11-23/h8,13-16H,4-7,9-12H2,1-3H3,(H,24,25) |
| InChIKey | MZNWVUXUBHOHQO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |