C14H14N2O5S — CID 108733797
ethyl 4-carbamoyl-2-methyl-5-(thiophene-2-carbonylamino)furan-3-carboxylate (PubChem CID 108733797) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is ethyl 4-carbamoyl-2-methyl-5-(thiophene-2-carbonylamino)furan-3-carboxylate.
| Compound Name | ethyl 4-carbamoyl-2-methyl-5-(thiophene-2-carbonylamino)furan-3-carboxylate |
|---|---|
| PubChem CID | 108733797 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | ethyl 4-carbamoyl-2-methyl-5-(thiophene-2-carbonylamino)furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(NC(=O)c2cccs2)c1C(N)=O |
| InChI | InChI=1S/C14H14N2O5S/c1-3-20-14(19)9-7(2)21-13(10(9)11(15)17)16-12(18)8-5-4-6-22-8/h4-6H,3H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | VIVLDFDNDCPCEW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |