C18H16N4O3S — CID 113050437
ethyl 4-[[6-(thiophene-2-carbonylamino)pyridazin-3-yl]amino]benzoate (PubChem CID 113050437) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is ethyl 4-[[6-(thiophene-2-carbonylamino)pyridazin-3-yl]amino]benzoate.
| Compound Name | ethyl 4-[[6-(thiophene-2-carbonylamino)pyridazin-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 113050437 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | ethyl 4-[[6-(thiophene-2-carbonylamino)pyridazin-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ccc(NC(=O)c3cccs3)nn2)cc1 |
| InChI | InChI=1S/C18H16N4O3S/c1-2-25-18(24)12-5-7-13(8-6-12)19-15-9-10-16(22-21-15)20-17(23)14-4-3-11-26-14/h3-11H,2H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | AICBMFNATGJYNK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |