C15H11FN4OS — CID 113047251
N-[6-(4-fluoroanilino)pyridazin-3-yl]thiophene-2-carboxamide (PubChem CID 113047251) has the molecular formula C15H11FN4OS and a molecular weight of 314.35 g/mol. Its IUPAC name is N-[6-(4-fluoroanilino)pyridazin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[6-(4-fluoroanilino)pyridazin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113047251 |
| Molecular Formula | C15H11FN4OS |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | N-[6-(4-fluoroanilino)pyridazin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(F)cc2)nn1)c1cccs1 |
| InChI | InChI=1S/C15H11FN4OS/c16-10-3-5-11(6-4-10)17-13-7-8-14(20-19-13)18-15(21)12-2-1-9-22-12/h1-9H,(H,17,19)(H,18,20,21) |
| InChIKey | CEXKGBBJJGWVDT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |