C17H12F3N3OS — CID 113034907
N-[5-[4-(trifluoromethyl)anilino]-2-pyridinyl]thiophene-2-carboxamide (PubChem CID 113034907) has the molecular formula C17H12F3N3OS and a molecular weight of 363.36 g/mol. Its IUPAC name is N-[5-[4-(trifluoromethyl)anilino]-2-pyridinyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[4-(trifluoromethyl)anilino]-2-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113034907 |
| Molecular Formula | C17H12F3N3OS |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-[5-[4-(trifluoromethyl)anilino]-2-pyridinyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(C(F)(F)F)cc2)cn1)c1cccs1 |
| InChI | InChI=1S/C17H12F3N3OS/c18-17(19,20)11-3-5-12(6-4-11)22-13-7-8-15(21-10-13)23-16(24)14-2-1-9-25-14/h1-10,22H,(H,21,23,24) |
| InChIKey | SVHJXRODIGWWRD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |