C17H12N4OS — CID 113037150
N-[5-(3-cyanoanilino)-2-pyridinyl]thiophene-2-carboxamide (PubChem CID 113037150) has the molecular formula C17H12N4OS and a molecular weight of 320.38 g/mol. Its IUPAC name is N-[5-(3-cyanoanilino)-2-pyridinyl]thiophene-2-carboxamide.
| Compound Name | N-[5-(3-cyanoanilino)-2-pyridinyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113037150 |
| Molecular Formula | C17H12N4OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[5-(3-cyanoanilino)-2-pyridinyl]thiophene-2-carboxamide |
| SMILES | N#Cc1cccc(Nc2ccc(NC(=O)c3cccs3)nc2)c1 |
| InChI | InChI=1S/C17H12N4OS/c18-10-12-3-1-4-13(9-12)20-14-6-7-16(19-11-14)21-17(22)15-5-2-8-23-15/h1-9,11,20H,(H,19,21,22) |
| InChIKey | USRWKEXVMDINEL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |