C22H17N3O2S2 — CID 67687159
N-[4-[4-(thiophene-2-carbonylamino)anilino]phenyl]thiophene-2-carboxamide (PubChem CID 67687159) has the molecular formula C22H17N3O2S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-[4-(thiophene-2-carbonylamino)anilino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-(thiophene-2-carbonylamino)anilino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67687159 |
| Molecular Formula | C22H17N3O2S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-[4-[4-(thiophene-2-carbonylamino)anilino]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc(NC(=O)c3cccs3)cc2)cc1)c1cccs1 |
| InChI | InChI=1S/C22H17N3O2S2/c26-21(19-3-1-13-28-19)24-17-9-5-15(6-10-17)23-16-7-11-18(12-8-16)25-22(27)20-4-2-14-29-20/h1-14,23H,(H,24,26)(H,25,27) |
| InChIKey | AIZQMNVSHQKLMK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |