C18H16N2OS — CID 112985944
N-[4-(3-methylanilino)phenyl]thiophene-2-carboxamide (PubChem CID 112985944) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is N-[4-(3-methylanilino)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(3-methylanilino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112985944 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-[4-(3-methylanilino)phenyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(Nc2ccc(NC(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C18H16N2OS/c1-13-4-2-5-16(12-13)19-14-7-9-15(10-8-14)20-18(21)17-6-3-11-22-17/h2-12,19H,1H3,(H,20,21) |
| InChIKey | FTROKMIAGZLJGZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |