C18H14N2O3S — CID 112989143
N-[4-(1,3-benzodioxol-5-ylamino)phenyl]thiophene-2-carboxamide (PubChem CID 112989143) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-ylamino)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-ylamino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112989143 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-ylamino)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2ccc3c(c2)OCO3)cc1)c1cccs1 |
| InChI | InChI=1S/C18H14N2O3S/c21-18(17-2-1-9-24-17)20-13-5-3-12(4-6-13)19-14-7-8-15-16(10-14)23-11-22-15/h1-10,19H,11H2,(H,20,21) |
| InChIKey | NLFWSFAKPAOIGS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |