C14H11NO4S — CID 94297417
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxo-2-thiophen-2-ylacetamide (PubChem CID 94297417) has the molecular formula C14H11NO4S and a molecular weight of 289.31 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxo-2-thiophen-2-ylacetamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxo-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 94297417 |
| Molecular Formula | C14H11NO4S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxo-2-thiophen-2-ylacetamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)C(=O)c1cccs1 |
| InChI | InChI=1S/C14H11NO4S/c16-13(12-2-1-7-20-12)14(17)15-9-3-4-10-11(8-9)19-6-5-18-10/h1-4,7-8H,5-6H2,(H,15,17) |
| InChIKey | CFKMLSPVQHVCGH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|