C16H13FN2O4 — CID 44997744
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-fluorophenyl)oxamide (PubChem CID 44997744) has the molecular formula C16H13FN2O4 and a molecular weight of 316.29 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-fluorophenyl)oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 44997744 |
| Molecular Formula | C16H13FN2O4 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-(4-fluorophenyl)oxamide |
| SMILES | O=C(Nc1ccc(F)cc1)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H13FN2O4/c17-10-1-3-11(4-2-10)18-15(20)16(21)19-12-5-6-13-14(9-12)23-8-7-22-13/h1-6,9H,7-8H2,(H,18,20)(H,19,21) |
| InChIKey | NAGAMRFNAUPXNJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|