C18H18N2O4 — CID 45000357
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(2,6-dimethylphenyl)oxamide (PubChem CID 45000357) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(2,6-dimethylphenyl)oxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(2,6-dimethylphenyl)oxamide |
|---|---|
| PubChem CID | 45000357 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-(2,6-dimethylphenyl)oxamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H18N2O4/c1-11-4-3-5-12(2)16(11)20-18(22)17(21)19-13-6-7-14-15(10-13)24-9-8-23-14/h3-7,10H,8-9H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | SXILMVJZFMYOIV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|