C22H16FNO4 — CID 36653806
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-fluorobenzoyl)benzamide (PubChem CID 36653806) has the molecular formula C22H16FNO4 and a molecular weight of 377.37 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-fluorobenzoyl)benzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-fluorobenzoyl)benzamide |
|---|---|
| PubChem CID | 36653806 |
| Molecular Formula | C22H16FNO4 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-fluorobenzoyl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccccc1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H16FNO4/c23-15-7-5-14(6-8-15)21(25)17-3-1-2-4-18(17)22(26)24-16-9-10-19-20(13-16)28-12-11-27-19/h1-10,13H,11-12H2,(H,24,26) |
| InChIKey | JFDYFMXKFUPSPU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |