C15H11F2NO3 — CID 2810385
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,6-difluorobenzamide (PubChem CID 2810385) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,6-difluorobenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 2810385 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1c(F)cccc1F |
| InChI | InChI=1S/C15H11F2NO3/c16-10-2-1-3-11(17)14(10)15(19)18-9-4-5-12-13(8-9)21-7-6-20-12/h1-5,8H,6-7H2,(H,18,19) |
| InChIKey | HIBLHRZHTNTKLJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |