C15H11ClFNO3 — CID 110764768
3-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide (PubChem CID 110764768) has the molecular formula C15H11ClFNO3 and a molecular weight of 307.71 g/mol. Its IUPAC name is 3-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide.
| Compound Name | 3-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 110764768 |
| Molecular Formula | C15H11ClFNO3 |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClFNO3/c16-11-7-9(1-3-12(11)17)15(19)18-10-2-4-13-14(8-10)21-6-5-20-13/h1-4,7-8H,5-6H2,(H,18,19) |
| InChIKey | DQRVDYRZEKVWGB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |