C14H8Cl2FNO3 — CID 9191596
N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-fluorobenzamide (PubChem CID 9191596) has the molecular formula C14H8Cl2FNO3 and a molecular weight of 328.13 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-fluorobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 9191596 |
| Molecular Formula | C14H8Cl2FNO3 |
| Molecular Weight | 328.13 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-fluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl2FNO3/c15-9-5-10(16)11(17)4-8(9)14(19)18-7-1-2-12-13(3-7)21-6-20-12/h1-5H,6H2,(H,18,19) |
| InChIKey | NRKKKVZYGXWFGA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.13 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|