C20H13Cl2FN2O5S — CID 2089595
N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzamide (PubChem CID 2089595) has the molecular formula C20H13Cl2FN2O5S and a molecular weight of 483.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2089595 |
| Molecular Formula | C20H13Cl2FN2O5S |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2,4-dichloro-5-[(4-fluorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cc(S(=O)(=O)Nc2ccc(F)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2FN2O5S/c21-15-9-16(22)19(31(27,28)25-12-3-1-11(23)2-4-12)8-14(15)20(26)24-13-5-6-17-18(7-13)30-10-29-17/h1-9,25H,10H2,(H,24,26) |
| InChIKey | HABHEMFKKCLBLC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |