C20H15FN2O5S — CID 2336815
N-(1,3-benzodioxol-5-yl)-2-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 2336815) has the molecular formula C20H15FN2O5S and a molecular weight of 414.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 2336815 |
| Molecular Formula | C20H15FN2O5S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccccc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN2O5S/c21-13-5-8-15(9-6-13)29(25,26)23-17-4-2-1-3-16(17)20(24)22-14-7-10-18-19(11-14)28-12-27-18/h1-11,23H,12H2,(H,22,24) |
| InChIKey | CMIKZYWVQBVTKU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |