C23H22FN3O3S — CID 55815022
2-[(4-fluorophenyl)sulfonylamino]-N-(3-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 55815022) has the molecular formula C23H22FN3O3S and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-(3-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(3-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 55815022 |
| Molecular Formula | C23H22FN3O3S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(3-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(N2CCCC2)c1)c1ccccc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FN3O3S/c24-17-10-12-20(13-11-17)31(29,30)26-22-9-2-1-8-21(22)23(28)25-18-6-5-7-19(16-18)27-14-3-4-15-27/h1-2,5-13,16,26H,3-4,14-15H2,(H,25,28) |
| InChIKey | UBHTYFDUCHNABW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|