C24H24FN3O5S2 — CID 2337095
2-[(4-fluorophenyl)sulfonylamino]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 2337095) has the molecular formula C24H24FN3O5S2 and a molecular weight of 517.60 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 2337095 |
| Molecular Formula | C24H24FN3O5S2 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(4-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccccc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FN3O5S2/c25-18-8-12-20(13-9-18)34(30,31)27-23-7-3-2-6-22(23)24(29)26-19-10-14-21(15-11-19)35(32,33)28-16-4-1-5-17-28/h2-3,6-15,27H,1,4-5,16-17H2,(H,26,29) |
| InChIKey | MBYLZOVYLVGCIZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |