C26H20FN3O4S — CID 55869973
N-(3-benzamidophenyl)-2-[(4-fluorophenyl)sulfonylamino]benzamide (PubChem CID 55869973) has the molecular formula C26H20FN3O4S and a molecular weight of 489.53 g/mol. Its IUPAC name is N-(3-benzamidophenyl)-2-[(4-fluorophenyl)sulfonylamino]benzamide.
| Compound Name | N-(3-benzamidophenyl)-2-[(4-fluorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 55869973 |
| Molecular Formula | C26H20FN3O4S |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | N-(3-benzamidophenyl)-2-[(4-fluorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2ccccc2NS(=O)(=O)c2ccc(F)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C26H20FN3O4S/c27-19-13-15-22(16-14-19)35(33,34)30-24-12-5-4-11-23(24)26(32)29-21-10-6-9-20(17-21)28-25(31)18-7-2-1-3-8-18/h1-17,30H,(H,28,31)(H,29,32) |
| InChIKey | FKCRMBHLRSJODL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |