C19H14F2N2O3S — CID 39948261
2-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]benzamide (PubChem CID 39948261) has the molecular formula C19H14F2N2O3S and a molecular weight of 388.40 g/mol. Its IUPAC name is 2-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 39948261 |
| Molecular Formula | C19H14F2N2O3S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-fluoro-N-[2-[(4-fluorophenyl)sulfonylamino]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1NS(=O)(=O)c1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C19H14F2N2O3S/c20-13-9-11-14(12-10-13)27(25,26)23-18-8-4-3-7-17(18)22-19(24)15-5-1-2-6-16(15)21/h1-12,23H,(H,22,24) |
| InChIKey | IWCUBDGLNCIJFU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |