C18H13FN4O3 — CID 109128499
N-(1,3-benzodioxol-5-yl)-6-(4-fluoroanilino)pyridazine-3-carboxamide (PubChem CID 109128499) has the molecular formula C18H13FN4O3 and a molecular weight of 352.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(4-fluoroanilino)pyridazine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(4-fluoroanilino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109128499 |
| Molecular Formula | C18H13FN4O3 |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(4-fluoroanilino)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(Nc2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C18H13FN4O3/c19-11-1-3-12(4-2-11)20-17-8-6-14(22-23-17)18(24)21-13-5-7-15-16(9-13)26-10-25-15/h1-9H,10H2,(H,20,23)(H,21,24) |
| InChIKey | MJPAGAMOJBZAQN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |