C15H14N4O3 — CID 109110351
N-(1,3-benzodioxol-5-yl)-6-(prop-2-enylamino)pyridazine-3-carboxamide (PubChem CID 109110351) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(prop-2-enylamino)pyridazine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(prop-2-enylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110351 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(prop-2-enylamino)pyridazine-3-carboxamide |
| SMILES | C=CCNc1ccc(C(=O)Nc2ccc3c(c2)OCO3)nn1 |
| InChI | InChI=1S/C15H14N4O3/c1-2-7-16-14-6-4-11(18-19-14)15(20)17-10-3-5-12-13(8-10)22-9-21-12/h2-6,8H,1,7,9H2,(H,16,19)(H,17,20) |
| InChIKey | ABJPBCNEJJCTTO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|