C16H18N4O — CID 109110282
N-(3,4-dimethylphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide (PubChem CID 109110282) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110282 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-6-(prop-2-enylamino)pyridazine-3-carboxamide |
| SMILES | C=CCNc1ccc(C(=O)Nc2ccc(C)c(C)c2)nn1 |
| InChI | InChI=1S/C16H18N4O/c1-4-9-17-15-8-7-14(19-20-15)16(21)18-13-6-5-11(2)12(3)10-13/h4-8,10H,1,9H2,2-3H3,(H,17,20)(H,18,21) |
| InChIKey | CQISXOFKQKXJNL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|