C16H16N4O3 — CID 109110332
methyl 4-[[6-(prop-2-enylamino)pyridazine-3-carbonyl]amino]benzoate (PubChem CID 109110332) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is methyl 4-[[6-(prop-2-enylamino)pyridazine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[6-(prop-2-enylamino)pyridazine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109110332 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 4-[[6-(prop-2-enylamino)pyridazine-3-carbonyl]amino]benzoate |
| SMILES | C=CCNc1ccc(C(=O)Nc2ccc(C(=O)OC)cc2)nn1 |
| InChI | InChI=1S/C16H16N4O3/c1-3-10-17-14-9-8-13(19-20-14)15(21)18-12-6-4-11(5-7-12)16(22)23-2/h3-9H,1,10H2,2H3,(H,17,20)(H,18,21) |
| InChIKey | IALUBEJORYRPHS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|