C9H11N3O2 — CID 60980581
methyl 6-(prop-2-enylamino)pyridazine-3-carboxylate (PubChem CID 60980581) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is methyl 6-(prop-2-enylamino)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(prop-2-enylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 60980581 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | methyl 6-(prop-2-enylamino)pyridazine-3-carboxylate |
| SMILES | C=CCNc1ccc(C(=O)OC)nn1 |
| InChI | InChI=1S/C9H11N3O2/c1-3-6-10-8-5-4-7(11-12-8)9(13)14-2/h3-5H,1,6H2,2H3,(H,10,12) |
| InChIKey | INWIMWFTMZYCFO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|