C10H15N3O2 — CID 24820196
methyl 6-(butylamino)pyridazine-3-carboxylate (PubChem CID 24820196) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is methyl 6-(butylamino)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(butylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 24820196 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | methyl 6-(butylamino)pyridazine-3-carboxylate |
| SMILES | CCCCNc1ccc(C(=O)OC)nn1 |
| InChI | InChI=1S/C10H15N3O2/c1-3-4-7-11-9-6-5-8(12-13-9)10(14)15-2/h5-6H,3-4,7H2,1-2H3,(H,11,13) |
| InChIKey | CTBKWWFFSIUXGF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|