C10H14N4O3 — CID 60968294
methyl 6-[[3-(methylamino)-3-oxopropyl]amino]pyridazine-3-carboxylate (PubChem CID 60968294) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is methyl 6-[[3-(methylamino)-3-oxopropyl]amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[[3-(methylamino)-3-oxopropyl]amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 60968294 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | methyl 6-[[3-(methylamino)-3-oxopropyl]amino]pyridazine-3-carboxylate |
| SMILES | CNC(=O)CCNc1ccc(C(=O)OC)nn1 |
| InChI | InChI=1S/C10H14N4O3/c1-11-9(15)5-6-12-8-4-3-7(13-14-8)10(16)17-2/h3-4H,5-6H2,1-2H3,(H,11,15)(H,12,14) |
| InChIKey | RNMFSVDKPHJMFH-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |