C12H19N3O2 — CID 60980718
methyl 6-(hexylamino)pyridazine-3-carboxylate (PubChem CID 60980718) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 6-(hexylamino)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(hexylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 60980718 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | methyl 6-(hexylamino)pyridazine-3-carboxylate |
| SMILES | CCCCCCNc1ccc(C(=O)OC)nn1 |
| InChI | InChI=1S/C12H19N3O2/c1-3-4-5-6-9-13-11-8-7-10(14-15-11)12(16)17-2/h7-8H,3-6,9H2,1-2H3,(H,13,15) |
| InChIKey | CYKVTOUNXMNRJN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|