C11H17N3O3 — CID 113244113
methyl 6-[(2-methoxy-2-methylpropyl)amino]pyridazine-3-carboxylate (PubChem CID 113244113) has the molecular formula C11H17N3O3 and a molecular weight of 239.28 g/mol. Its IUPAC name is methyl 6-[(2-methoxy-2-methylpropyl)amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(2-methoxy-2-methylpropyl)amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 113244113 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | methyl 6-[(2-methoxy-2-methylpropyl)amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCC(C)(C)OC)nn1 |
| InChI | InChI=1S/C11H17N3O3/c1-11(2,17-4)7-12-9-6-5-8(13-14-9)10(15)16-3/h5-6H,7H2,1-4H3,(H,12,14) |
| InChIKey | GESRUXYFEQGZFC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |