C10H15N3O4 — CID 107390127
methyl 6-(2,2-dimethoxyethylamino)pyridazine-3-carboxylate (PubChem CID 107390127) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 6-(2,2-dimethoxyethylamino)pyridazine-3-carboxylate.
| Compound Name | methyl 6-(2,2-dimethoxyethylamino)pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 107390127 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl 6-(2,2-dimethoxyethylamino)pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCC(OC)OC)nn1 |
| InChI | InChI=1S/C10H15N3O4/c1-15-9(16-2)6-11-8-5-4-7(12-13-8)10(14)17-3/h4-5,9H,6H2,1-3H3,(H,11,13) |
| InChIKey | XVAXQXVEJWRBDB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|