C14H14FN3O3 — CID 95257213
methyl 6-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]pyridazine-3-carboxylate (PubChem CID 95257213) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is methyl 6-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 95257213 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | methyl 6-[[(2R)-2-(3-fluorophenyl)-2-hydroxyethyl]amino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NC[C@H](O)c2cccc(F)c2)nn1 |
| InChI | InChI=1S/C14H14FN3O3/c1-21-14(20)11-5-6-13(18-17-11)16-8-12(19)9-3-2-4-10(15)7-9/h2-7,12,19H,8H2,1H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | DUGXYYXNSXWLSW-LBPRGKRZSA-N |
| XLogP | 1.55 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |